C22H25ClN4O3S — CID 46426763
2-chloro-5-(dimethylsulfamoyl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]benzamide (PubChem CID 46426763) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]benzamide.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 46426763 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)-N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]benzamide |
| SMILES | Cc1nn(-c2ccccc2)cc1CCCNC(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C22H25ClN4O3S/c1-16-17(15-27(25-16)18-9-5-4-6-10-18)8-7-13-24-22(28)20-14-19(11-12-21(20)23)31(29,30)26(2)3/h4-6,9-12,14-15H,7-8,13H2,1-3H3,(H,24,28) |
| InChIKey | FSBPZSOLGQPCCK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|