C25H33N7O2 — CID 46545559
4-oxo-3-pentyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]phthalazine-1-carboxamide (PubChem CID 46545559) has the molecular formula C25H33N7O2 and a molecular weight of 463.59 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]phthalazine-1-carboxamide.
| Compound Name | 4-oxo-3-pentyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 46545559 |
| Molecular Formula | C25H33N7O2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 4-oxo-3-pentyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]phthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)NCCCN2CCN(c3ncccn3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H33N7O2/c1-2-3-6-15-32-24(34)21-10-5-4-9-20(21)22(29-32)23(33)26-13-8-14-30-16-18-31(19-17-30)25-27-11-7-12-28-25/h4-5,7,9-12H,2-3,6,8,13-19H2,1H3,(H,26,33) |
| InChIKey | CFYANFJVXLHOLP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|