C25H31N4O2+ — CID 9463679
3-butyl-4-oxo-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]phthalazine-1-carboxamide (PubChem CID 9463679) has the molecular formula C25H31N4O2+ and a molecular weight of 419.55 g/mol. Its IUPAC name is 3-butyl-4-oxo-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]phthalazine-1-carboxamide.
| Compound Name | 3-butyl-4-oxo-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9463679 |
| Molecular Formula | C25H31N4O2+ |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 3-butyl-4-oxo-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]phthalazine-1-carboxamide |
| SMILES | CCCCn1nc(C(=O)NCc2ccccc2C[NH+]2CCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H30N4O2/c1-2-3-16-29-25(31)22-13-7-6-12-21(22)23(27-29)24(30)26-17-19-10-4-5-11-20(19)18-28-14-8-9-15-28/h4-7,10-13H,2-3,8-9,14-18H2,1H3,(H,26,30)/p+1 |
| InChIKey | HBHWPOSQLNPEQH-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |