C22H25N4O4+ — CID 3712402
3-(2-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)-4-oxophthalazine-1-carboxamide (PubChem CID 3712402) has the molecular formula C22H25N4O4+ and a molecular weight of 409.47 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-(2-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 3712402 |
| Molecular Formula | C22H25N4O4+ |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)-4-oxophthalazine-1-carboxamide |
| SMILES | COc1ccccc1-n1nc(C(=O)NCC[NH+]2CCOCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H24N4O4/c1-29-19-9-5-4-8-18(19)26-22(28)17-7-3-2-6-16(17)20(24-26)21(27)23-10-11-25-12-14-30-15-13-25/h2-9H,10-15H2,1H3,(H,23,27)/p+1 |
| InChIKey | NZHKMANIINFNIA-UHFFFAOYSA-O |
| XLogP | 0.04 |
| TPSA | 86.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |