C28H31N4O3+ — CID 4090991
benzyl-ethyl-[3-[[3-(2-methoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]propyl]azanium (PubChem CID 4090991) has the molecular formula C28H31N4O3+ and a molecular weight of 471.58 g/mol. Its IUPAC name is benzyl-ethyl-[3-[[3-(2-methoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]propyl]azanium.
| Compound Name | benzyl-ethyl-[3-[[3-(2-methoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 4090991 |
| Molecular Formula | C28H31N4O3+ |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | benzyl-ethyl-[3-[[3-(2-methoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]propyl]azanium |
| SMILES | CC[NH+](CCCNC(=O)c1nn(-c2ccccc2OC)c(=O)c2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C28H30N4O3/c1-3-31(20-21-12-5-4-6-13-21)19-11-18-29-27(33)26-22-14-7-8-15-23(22)28(34)32(30-26)24-16-9-10-17-25(24)35-2/h4-10,12-17H,3,11,18-20H2,1-2H3,(H,29,33)/p+1 |
| InChIKey | JZDRDIQFKDUTQK-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|