C21H25N4O2+ — CID 9049370
benzyl-methyl-[3-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]propyl]azanium (PubChem CID 9049370) has the molecular formula C21H25N4O2+ and a molecular weight of 365.46 g/mol. Its IUPAC name is benzyl-methyl-[3-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]propyl]azanium.
| Compound Name | benzyl-methyl-[3-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 9049370 |
| Molecular Formula | C21H25N4O2+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | benzyl-methyl-[3-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]propyl]azanium |
| SMILES | Cn1nc(C(=O)NCCC[NH+](C)Cc2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H24N4O2/c1-24(15-16-9-4-3-5-10-16)14-8-13-22-20(26)19-17-11-6-7-12-18(17)21(27)25(2)23-19/h3-7,9-12H,8,13-15H2,1-2H3,(H,22,26)/p+1 |
| InChIKey | ZWOOUEQNTBIQHZ-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|