C19H19N3O3 — CID 31526897
N-[2-(2-methoxyphenyl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 31526897) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[2-(2-methoxyphenyl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 31526897 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[2-(2-methoxyphenyl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | COc1ccccc1CCNC(=O)c1nn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H19N3O3/c1-22-19(24)15-9-5-4-8-14(15)17(21-22)18(23)20-12-11-13-7-3-6-10-16(13)25-2/h3-10H,11-12H2,1-2H3,(H,20,23) |
| InChIKey | QLUAQJSPTLNNBE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |