C19H17N3O4 — CID 71709074
N-[2-(4-methoxyphenyl)-2-oxoethyl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 71709074) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-2-oxoethyl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[2-(4-methoxyphenyl)-2-oxoethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 71709074 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-2-oxoethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | COc1ccc(C(=O)CNC(=O)c2nn(C)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C19H17N3O4/c1-22-19(25)15-6-4-3-5-14(15)17(21-22)18(24)20-11-16(23)12-7-9-13(26-2)10-8-12/h3-10H,11H2,1-2H3,(H,20,24) |
| InChIKey | UEPFNXGOCJUETE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |