C18H16N4O3 — CID 7750621
3-methyl-4-oxo-N'-(2-phenylacetyl)phthalazine-1-carbohydrazide (PubChem CID 7750621) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-methyl-4-oxo-N'-(2-phenylacetyl)phthalazine-1-carbohydrazide.
| Compound Name | 3-methyl-4-oxo-N'-(2-phenylacetyl)phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 7750621 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-methyl-4-oxo-N'-(2-phenylacetyl)phthalazine-1-carbohydrazide |
| SMILES | Cn1nc(C(=O)NNC(=O)Cc2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H16N4O3/c1-22-18(25)14-10-6-5-9-13(14)16(21-22)17(24)20-19-15(23)11-12-7-3-2-4-8-12/h2-10H,11H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | UOVWMXKNHBBSOS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|