C14H12N6O3 — CID 60520729
3-methyl-4-oxo-N'-(1H-pyrazole-5-carbonyl)phthalazine-1-carbohydrazide (PubChem CID 60520729) has the molecular formula C14H12N6O3 and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-methyl-4-oxo-N'-(1H-pyrazole-5-carbonyl)phthalazine-1-carbohydrazide.
| Compound Name | 3-methyl-4-oxo-N'-(1H-pyrazole-5-carbonyl)phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 60520729 |
| Molecular Formula | C14H12N6O3 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-methyl-4-oxo-N'-(1H-pyrazole-5-carbonyl)phthalazine-1-carbohydrazide |
| SMILES | Cn1nc(C(=O)NNC(=O)c2ccn[nH]2)c2ccccc2c1=O |
| InChI | InChI=1S/C14H12N6O3/c1-20-14(23)9-5-3-2-4-8(9)11(19-20)13(22)18-17-12(21)10-6-7-15-16-10/h2-7H,1H3,(H,15,16)(H,17,21)(H,18,22) |
| InChIKey | RMWGVBMLVRTQIM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|