C17H15N5O5 — CID 4854734
N-(furan-2-ylmethyl)-2-[2-(3-methyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-2-oxoacetamide (PubChem CID 4854734) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[2-(3-methyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-2-oxoacetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[2-(3-methyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 4854734 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[2-(3-methyl-4-oxophthalazine-1-carbonyl)hydrazinyl]-2-oxoacetamide |
| SMILES | Cn1nc(C(=O)NNC(=O)C(=O)NCc2ccco2)c2ccccc2c1=O |
| InChI | InChI=1S/C17H15N5O5/c1-22-17(26)12-7-3-2-6-11(12)13(21-22)14(23)19-20-16(25)15(24)18-9-10-5-4-8-27-10/h2-8H,9H2,1H3,(H,18,24)(H,19,23)(H,20,25) |
| InChIKey | GWUSRJJTNZWQGW-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 135.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|