C21H18N4O5S — CID 2483251
N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 2483251) has the molecular formula C21H18N4O5S and a molecular weight of 438.47 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 2483251 |
| Molecular Formula | C21H18N4O5S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(S(=O)(=O)NCc3ccco3)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H18N4O5S/c1-25-21(27)18-7-3-2-6-17(18)19(24-25)20(26)23-14-8-10-16(11-9-14)31(28,29)22-13-15-5-4-12-30-15/h2-12,22H,13H2,1H3,(H,23,26) |
| InChIKey | LBNGSYTWRKCINA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |