C18H19N3O3 — CID 9141827
N-[(2S)-4-(furan-2-yl)butan-2-yl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 9141827) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(2S)-4-(furan-2-yl)butan-2-yl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(2S)-4-(furan-2-yl)butan-2-yl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9141827 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[(2S)-4-(furan-2-yl)butan-2-yl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | C[C@@H](CCc1ccco1)NC(=O)c1nn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H19N3O3/c1-12(9-10-13-6-5-11-24-13)19-17(22)16-14-7-3-4-8-15(14)18(23)21(2)20-16/h3-8,11-12H,9-10H2,1-2H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | KJZOSFZIWUZLAG-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |