C14H15N3O5 — CID 9277699
methyl (2S)-3-hydroxy-2-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]propanoate (PubChem CID 9277699) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl (2S)-3-hydroxy-2-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]propanoate.
| Compound Name | methyl (2S)-3-hydroxy-2-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 9277699 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | methyl (2S)-3-hydroxy-2-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)c1nn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C14H15N3O5/c1-17-13(20)9-6-4-3-5-8(9)11(16-17)12(19)15-10(7-18)14(21)22-2/h3-6,10,18H,7H2,1-2H3,(H,15,19)/t10-/m0/s1 |
| InChIKey | UEDGINIBJIEAON-JTQLQIEISA-N |
| XLogP | -0.80 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |