C16H15N3O3 — CID 9481891
N-[(1R)-1-(furan-2-yl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 9481891) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9481891 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-3-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nn(C)c(=O)c2ccccc12)c1ccco1 |
| InChI | InChI=1S/C16H15N3O3/c1-10(13-8-5-9-22-13)17-15(20)14-11-6-3-4-7-12(11)16(21)19(2)18-14/h3-10H,1-2H3,(H,17,20)/t10-/m1/s1 |
| InChIKey | SSTLVADSVLKSFO-SNVBAGLBSA-N |
| XLogP | 2.02 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |