C17H12F3N5O4 — CID 24608336
3-methyl-4-oxo-N'-[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]phthalazine-1-carbohydrazide (PubChem CID 24608336) has the molecular formula C17H12F3N5O4 and a molecular weight of 407.31 g/mol. Its IUPAC name is 3-methyl-4-oxo-N'-[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]phthalazine-1-carbohydrazide.
| Compound Name | 3-methyl-4-oxo-N'-[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 24608336 |
| Molecular Formula | C17H12F3N5O4 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-methyl-4-oxo-N'-[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]phthalazine-1-carbohydrazide |
| SMILES | Cn1nc(C(=O)NNC(=O)c2ccc(C(F)(F)F)[nH]c2=O)c2ccccc2c1=O |
| InChI | InChI=1S/C17H12F3N5O4/c1-25-16(29)9-5-3-2-4-8(9)12(24-25)15(28)23-22-14(27)10-6-7-11(17(18,19)20)21-13(10)26/h2-7H,1H3,(H,21,26)(H,22,27)(H,23,28) |
| InChIKey | FCFOQWWXEOJFNB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|