C16H17F3N2O2 — CID 155571822
N-benzyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide;ethane (PubChem CID 155571822) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is N-benzyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide;ethane.
| Compound Name | N-benzyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 155571822 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-benzyl-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide;ethane |
| SMILES | CC.O=C(NCc1ccccc1)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C14H11F3N2O2.C2H6/c15-14(16,17)11-7-6-10(13(21)19-11)12(20)18-8-9-4-2-1-3-5-9;1-2/h1-7H,8H2,(H,18,20)(H,19,21);1-2H3 |
| InChIKey | RAWYUNVFRIBTQW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |