C15H12F4N2O2 — CID 39192446
N-[2-(2-fluorophenyl)ethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 39192446) has the molecular formula C15H12F4N2O2 and a molecular weight of 328.26 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39192446 |
| Molecular Formula | C15H12F4N2O2 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C15H12F4N2O2/c16-11-4-2-1-3-9(11)7-8-20-13(22)10-5-6-12(15(17,18)19)21-14(10)23/h1-6H,7-8H2,(H,20,22)(H,21,23) |
| InChIKey | PTFRADKMMILJJG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |