C16H15F3N2O3 — CID 111825067
N-(2-hydroxy-2-phenylpropyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 111825067) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylpropyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-phenylpropyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 111825067 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(2-hydroxy-2-phenylpropyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | CC(O)(CNC(=O)c1ccc(C(F)(F)F)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C16H15F3N2O3/c1-15(24,10-5-3-2-4-6-10)9-20-13(22)11-7-8-12(16(17,18)19)21-14(11)23/h2-8,24H,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | YKDJOYLMCXLGPO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |