C10H9F3N2O4 — CID 43170817
2-[[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]propanoic acid (PubChem CID 43170817) has the molecular formula C10H9F3N2O4 and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-[[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43170817 |
| Molecular Formula | C10H9F3N2O4 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[[2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)c1ccc(C(F)(F)F)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C10H9F3N2O4/c1-4(9(18)19)14-7(16)5-2-3-6(10(11,12)13)15-8(5)17/h2-4H,1H3,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | XVIMIRXEZGFDMO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |