C10H10F3N3O4 — CID 106164652
N-(3-amino-2-hydroxy-3-oxopropyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 106164652) has the molecular formula C10H10F3N3O4 and a molecular weight of 293.20 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106164652 |
| Molecular Formula | C10H10F3N3O4 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)C(O)CNC(=O)c1ccc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C10H10F3N3O4/c11-10(12,13)6-2-1-4(9(20)16-6)8(19)15-3-5(17)7(14)18/h1-2,5,17H,3H2,(H2,14,18)(H,15,19)(H,16,20) |
| InChIKey | CBMSVLDJCFKCIL-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |