C15H16N2O3 — CID 111335230
N-(2-hydroxy-2-phenylpropyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 111335230) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylpropyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-phenylpropyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 111335230 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(2-hydroxy-2-phenylpropyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC(O)(CNC(=O)c1ccc[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O3/c1-15(20,11-6-3-2-4-7-11)10-17-14(19)12-8-5-9-16-13(12)18/h2-9,20H,10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | FLJCOXSANCZYMO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |