C13H20N2O3 — CID 103900087
N-(5-hydroxy-2,2-dimethylpentyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 103900087) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-(5-hydroxy-2,2-dimethylpentyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(5-hydroxy-2,2-dimethylpentyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103900087 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-(5-hydroxy-2,2-dimethylpentyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC(C)(CCCO)CNC(=O)c1ccc[nH]c1=O |
| InChI | InChI=1S/C13H20N2O3/c1-13(2,6-4-8-16)9-15-12(18)10-5-3-7-14-11(10)17/h3,5,7,16H,4,6,8-9H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | CJPYVXXGLVBTPU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |