C10H15N3O2 — CID 43600703
N-[3-(methylamino)propyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 43600703) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[3-(methylamino)propyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43600703 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-[3-(methylamino)propyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CNCCCNC(=O)c1ccc[nH]c1=O |
| InChI | InChI=1S/C10H15N3O2/c1-11-5-3-7-13-10(15)8-4-2-6-12-9(8)14/h2,4,6,11H,3,5,7H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | RDOWUPOEOWATQC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|