C20H22N4O3S — CID 92530601
N'-(4-ethyl-5-propylthiophene-2-carbonyl)-3-methyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 92530601) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N'-(4-ethyl-5-propylthiophene-2-carbonyl)-3-methyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-(4-ethyl-5-propylthiophene-2-carbonyl)-3-methyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 92530601 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N'-(4-ethyl-5-propylthiophene-2-carbonyl)-3-methyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCCc1sc(C(=O)NNC(=O)c2nn(C)c(=O)c3ccccc23)cc1CC |
| InChI | InChI=1S/C20H22N4O3S/c1-4-8-15-12(5-2)11-16(28-15)18(25)21-22-19(26)17-13-9-6-7-10-14(13)20(27)24(3)23-17/h6-7,9-11H,4-5,8H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | KBXWLNFDUBMFHY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|