C17H12ClIN4O3 — CID 60520758
N'-(4-chloro-3-iodobenzoyl)-3-methyl-4-oxophthalazine-1-carbohydrazide (PubChem CID 60520758) has the molecular formula C17H12ClIN4O3 and a molecular weight of 482.67 g/mol. Its IUPAC name is N'-(4-chloro-3-iodobenzoyl)-3-methyl-4-oxophthalazine-1-carbohydrazide.
| Compound Name | N'-(4-chloro-3-iodobenzoyl)-3-methyl-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 60520758 |
| Molecular Formula | C17H12ClIN4O3 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 481.96 |
| IUPAC Name | N'-(4-chloro-3-iodobenzoyl)-3-methyl-4-oxophthalazine-1-carbohydrazide |
| SMILES | Cn1nc(C(=O)NNC(=O)c2ccc(Cl)c(I)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C17H12ClIN4O3/c1-23-17(26)11-5-3-2-4-10(11)14(22-23)16(25)21-20-15(24)9-6-7-12(18)13(19)8-9/h2-8H,1H3,(H,20,24)(H,21,25) |
| InChIKey | ZTTFTVJCIAICLS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|