C18H15N5O5 — CID 3953032
3-methyl-N'-(3-methyl-4-nitrobenzoyl)-4-oxophthalazine-1-carbohydrazide (PubChem CID 3953032) has the molecular formula C18H15N5O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is 3-methyl-N'-(3-methyl-4-nitrobenzoyl)-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-methyl-N'-(3-methyl-4-nitrobenzoyl)-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 3953032 |
| Molecular Formula | C18H15N5O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-methyl-N'-(3-methyl-4-nitrobenzoyl)-4-oxophthalazine-1-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2nn(C)c(=O)c3ccccc23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N5O5/c1-10-9-11(7-8-14(10)23(27)28)16(24)19-20-17(25)15-12-5-3-4-6-13(12)18(26)22(2)21-15/h3-9H,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | PJRCWMOQUHSQTL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|