C26H32N4O3 — CID 20970821
N-[3-(2-ethylpiperidin-1-yl)propyl]-3-(2-methoxyphenyl)-4-oxophthalazine-1-carboxamide (PubChem CID 20970821) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-3-(2-methoxyphenyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-3-(2-methoxyphenyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 20970821 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-3-(2-methoxyphenyl)-4-oxophthalazine-1-carboxamide |
| SMILES | CCC1CCCCN1CCCNC(=O)c1nn(-c2ccccc2OC)c(=O)c2ccccc12 |
| InChI | InChI=1S/C26H32N4O3/c1-3-19-11-8-9-17-29(19)18-10-16-27-25(31)24-20-12-4-5-13-21(20)26(32)30(28-24)22-14-6-7-15-23(22)33-2/h4-7,12-15,19H,3,8-11,16-18H2,1-2H3,(H,27,31) |
| InChIKey | ZWHPBOGAXNSMFV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|