C28H35N5O5 — CID 22334006
3-(2,4-dimethoxyphenyl)-N-[2-[3-(4-methylpiperidin-1-yl)propylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide (PubChem CID 22334006) has the molecular formula C28H35N5O5 and a molecular weight of 521.62 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-N-[2-[3-(4-methylpiperidin-1-yl)propylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-N-[2-[3-(4-methylpiperidin-1-yl)propylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 22334006 |
| Molecular Formula | C28H35N5O5 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-N-[2-[3-(4-methylpiperidin-1-yl)propylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)NCC(=O)NCCCN3CCC(C)CC3)c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C28H35N5O5/c1-19-11-15-32(16-12-19)14-6-13-29-25(34)18-30-27(35)26-21-7-4-5-8-22(21)28(36)33(31-26)23-10-9-20(37-2)17-24(23)38-3/h4-5,7-10,17,19H,6,11-16,18H2,1-3H3,(H,29,34)(H,30,35) |
| InChIKey | UHJKNKSBEQKNDH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|