C29H37N5O5 — CID 22334172
3-(3,4-dimethoxyphenyl)-N-[2-[3-(3,5-dimethylpiperidin-1-yl)propylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide (PubChem CID 22334172) has the molecular formula C29H37N5O5 and a molecular weight of 535.65 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-[3-(3,5-dimethylpiperidin-1-yl)propylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-[3-(3,5-dimethylpiperidin-1-yl)propylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 22334172 |
| Molecular Formula | C29H37N5O5 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-[3-(3,5-dimethylpiperidin-1-yl)propylamino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)NCC(=O)NCCCN3CC(C)CC(C)C3)c3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C29H37N5O5/c1-19-14-20(2)18-33(17-19)13-7-12-30-26(35)16-31-28(36)27-22-8-5-6-9-23(22)29(37)34(32-27)21-10-11-24(38-3)25(15-21)39-4/h5-6,8-11,15,19-20H,7,12-14,16-18H2,1-4H3,(H,30,35)(H,31,36) |
| InChIKey | BPIXVGVDHTVLOW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|