C23H29N4O3+ — CID 3362601
diethyl-[3-[[3-(3-methoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]propyl]azanium (PubChem CID 3362601) has the molecular formula C23H29N4O3+ and a molecular weight of 409.51 g/mol. Its IUPAC name is diethyl-[3-[[3-(3-methoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]propyl]azanium.
| Compound Name | diethyl-[3-[[3-(3-methoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 3362601 |
| Molecular Formula | C23H29N4O3+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | diethyl-[3-[[3-(3-methoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCNC(=O)c1nn(-c2cccc(OC)c2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C23H28N4O3/c1-4-26(5-2)15-9-14-24-22(28)21-19-12-6-7-13-20(19)23(29)27(25-21)17-10-8-11-18(16-17)30-3/h6-8,10-13,16H,4-5,9,14-15H2,1-3H3,(H,24,28)/p+1 |
| InChIKey | CWEDDYXWDQLOEL-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|