C25H33N4O3+ — CID 3497730
butyl-[2-[[3-(4-ethoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]ethyl]-ethylazanium (PubChem CID 3497730) has the molecular formula C25H33N4O3+ and a molecular weight of 437.56 g/mol. Its IUPAC name is butyl-[2-[[3-(4-ethoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]ethyl]-ethylazanium.
| Compound Name | butyl-[2-[[3-(4-ethoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]ethyl]-ethylazanium |
|---|---|
| PubChem CID | 3497730 |
| Molecular Formula | C25H33N4O3+ |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | butyl-[2-[[3-(4-ethoxyphenyl)-4-oxophthalazine-1-carbonyl]amino]ethyl]-ethylazanium |
| SMILES | CCCC[NH+](CC)CCNC(=O)c1nn(-c2ccc(OCC)cc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H32N4O3/c1-4-7-17-28(5-2)18-16-26-24(30)23-21-10-8-9-11-22(21)25(31)29(27-23)19-12-14-20(15-13-19)32-6-3/h8-15H,4-7,16-18H2,1-3H3,(H,26,30)/p+1 |
| InChIKey | YBNFBTPHSQIMMA-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |