C18H25N5O2S2 — CID 8749401
1-[(3-butyl-4-oxophthalazine-1-carbonyl)amino]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 8749401) has the molecular formula C18H25N5O2S2 and a molecular weight of 407.57 g/mol. Its IUPAC name is 1-[(3-butyl-4-oxophthalazine-1-carbonyl)amino]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[(3-butyl-4-oxophthalazine-1-carbonyl)amino]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 8749401 |
| Molecular Formula | C18H25N5O2S2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-[(3-butyl-4-oxophthalazine-1-carbonyl)amino]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CCCCn1nc(C(=O)NNC(=S)NCCCSC)c2ccccc2c1=O |
| InChI | InChI=1S/C18H25N5O2S2/c1-3-4-11-23-17(25)14-9-6-5-8-13(14)15(22-23)16(24)20-21-18(26)19-10-7-12-27-2/h5-6,8-9H,3-4,7,10-12H2,1-2H3,(H,20,24)(H2,19,21,26) |
| InChIKey | SXGVQFLUIGFOHT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|