C18H24N6O3S — CID 8746128
1-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 8746128) has the molecular formula C18H24N6O3S and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8746128 |
| Molecular Formula | C18H24N6O3S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCn1nc(C(=O)NNC(=S)NCCN2CCOCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C18H24N6O3S/c1-2-24-17(26)14-6-4-3-5-13(14)15(22-24)16(25)20-21-18(28)19-7-8-23-9-11-27-12-10-23/h3-6H,2,7-12H2,1H3,(H,20,25)(H2,19,21,28) |
| InChIKey | DGJQOXPRXQQYNH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|