C18H23N5O5S — CID 16580980
3-ethyl-N'-(1-methylsulfonylpiperidine-2-carbonyl)-4-oxophthalazine-1-carbohydrazide (PubChem CID 16580980) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-ethyl-N'-(1-methylsulfonylpiperidine-2-carbonyl)-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-ethyl-N'-(1-methylsulfonylpiperidine-2-carbonyl)-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 16580980 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 3-ethyl-N'-(1-methylsulfonylpiperidine-2-carbonyl)-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)C2CCCCN2S(C)(=O)=O)c2ccccc2c1=O |
| InChI | InChI=1S/C18H23N5O5S/c1-3-22-18(26)13-9-5-4-8-12(13)15(21-22)17(25)20-19-16(24)14-10-6-7-11-23(14)29(2,27)28/h4-5,8-9,14H,3,6-7,10-11H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | LSUPAROQPQYMLD-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|