C22H23N5O5 — CID 26281878
3-ethyl-N'-[1-(furan-2-carbonyl)piperidine-4-carbonyl]-4-oxophthalazine-1-carbohydrazide (PubChem CID 26281878) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is 3-ethyl-N'-[1-(furan-2-carbonyl)piperidine-4-carbonyl]-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-ethyl-N'-[1-(furan-2-carbonyl)piperidine-4-carbonyl]-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 26281878 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-ethyl-N'-[1-(furan-2-carbonyl)piperidine-4-carbonyl]-4-oxophthalazine-1-carbohydrazide |
| SMILES | CCn1nc(C(=O)NNC(=O)C2CCN(C(=O)c3ccco3)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H23N5O5/c1-2-27-21(30)16-7-4-3-6-15(16)18(25-27)20(29)24-23-19(28)14-9-11-26(12-10-14)22(31)17-8-5-13-32-17/h3-8,13-14H,2,9-12H2,1H3,(H,23,28)(H,24,29) |
| InChIKey | WZOVPNXZSZUIMR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|