C25H26N4O3 — CID 55903511
1-(3-benzyl-4-oxophthalazine-1-carbonyl)-N-cyclopropylpiperidine-4-carboxamide (PubChem CID 55903511) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-(3-benzyl-4-oxophthalazine-1-carbonyl)-N-cyclopropylpiperidine-4-carboxamide.
| Compound Name | 1-(3-benzyl-4-oxophthalazine-1-carbonyl)-N-cyclopropylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55903511 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-(3-benzyl-4-oxophthalazine-1-carbonyl)-N-cyclopropylpiperidine-4-carboxamide |
| SMILES | O=C(NC1CC1)C1CCN(C(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C25H26N4O3/c30-23(26-19-10-11-19)18-12-14-28(15-13-18)25(32)22-20-8-4-5-9-21(20)24(31)29(27-22)16-17-6-2-1-3-7-17/h1-9,18-19H,10-16H2,(H,26,30) |
| InChIKey | KBALQNJVIFYYRX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |