C22H24N4O2 — CID 78769150
2-benzyl-4-(4-methyl-1,4-diazepane-1-carbonyl)phthalazin-1-one (PubChem CID 78769150) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-benzyl-4-(4-methyl-1,4-diazepane-1-carbonyl)phthalazin-1-one.
| Compound Name | 2-benzyl-4-(4-methyl-1,4-diazepane-1-carbonyl)phthalazin-1-one |
|---|---|
| PubChem CID | 78769150 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-benzyl-4-(4-methyl-1,4-diazepane-1-carbonyl)phthalazin-1-one |
| SMILES | CN1CCCN(C(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C22H24N4O2/c1-24-12-7-13-25(15-14-24)22(28)20-18-10-5-6-11-19(18)21(27)26(23-20)16-17-8-3-2-4-9-17/h2-6,8-11H,7,12-16H2,1H3 |
| InChIKey | XCZLIGZRKLKHIU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |