C24H27N3O2S — CID 99807086
2-benzyl-4-[(3R)-3-ethylsulfanylazepane-1-carbonyl]phthalazin-1-one (PubChem CID 99807086) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-benzyl-4-[(3R)-3-ethylsulfanylazepane-1-carbonyl]phthalazin-1-one.
| Compound Name | 2-benzyl-4-[(3R)-3-ethylsulfanylazepane-1-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 99807086 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-benzyl-4-[(3R)-3-ethylsulfanylazepane-1-carbonyl]phthalazin-1-one |
| SMILES | CCS[C@@H]1CCCCN(C(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)C1 |
| InChI | InChI=1S/C24H27N3O2S/c1-2-30-19-12-8-9-15-26(17-19)24(29)22-20-13-6-7-14-21(20)23(28)27(25-22)16-18-10-4-3-5-11-18/h3-7,10-11,13-14,19H,2,8-9,12,15-17H2,1H3/t19-/m1/s1 |
| InChIKey | BGGKYYKFPYPLDZ-LJQANCHMSA-N |
| XLogP | 4.19 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |