C28H28N4O2 — CID 3942601
2-benzyl-4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]phthalazin-1-one (PubChem CID 3942601) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-benzyl-4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]phthalazin-1-one.
| Compound Name | 2-benzyl-4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]phthalazin-1-one |
|---|---|
| PubChem CID | 3942601 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-benzyl-4-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]phthalazin-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)c3nn(Cc4ccccc4)c(=O)c4ccccc34)CC2)c1C |
| InChI | InChI=1S/C28H28N4O2/c1-20-9-8-14-25(21(20)2)30-15-17-31(18-16-30)28(34)26-23-12-6-7-13-24(23)27(33)32(29-26)19-22-10-4-3-5-11-22/h3-14H,15-19H2,1-2H3 |
| InChIKey | NLDDMUXCUZLTIE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |