C26H24N6O4 — CID 46612326
N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1-(furan-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 46612326) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1-(furan-2-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1-(furan-2-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 46612326 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1-(furan-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(C(=O)c2ccco2)CC1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H24N6O4/c33-24(19-13-15-31(16-14-19)26(35)21-12-7-17-36-21)28-29-25(34)22-27-23(18-8-3-1-4-9-18)32(30-22)20-10-5-2-6-11-20/h1-12,17,19H,13-16H2,(H,28,33)(H,29,34) |
| InChIKey | VVFVVYYWMVCKLA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 122.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|