C25H24N8O2 — CID 55576324
N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1-pyrimidin-2-ylpiperidine-3-carbohydrazide (PubChem CID 55576324) has the molecular formula C25H24N8O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1-pyrimidin-2-ylpiperidine-3-carbohydrazide.
| Compound Name | N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1-pyrimidin-2-ylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55576324 |
| Molecular Formula | C25H24N8O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1-pyrimidin-2-ylpiperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN(c2ncccn2)C1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H24N8O2/c34-23(19-11-7-16-32(17-19)25-26-14-8-15-27-25)29-30-24(35)21-28-22(18-9-3-1-4-10-18)33(31-21)20-12-5-2-6-13-20/h1-6,8-10,12-15,19H,7,11,16-17H2,(H,29,34)(H,30,35) |
| InChIKey | VJFIOTOPDNTWEO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|