C20H22N6O2 — CID 134034978
1-methyl-N'-(1-pyrimidin-2-ylpiperidine-3-carbonyl)indole-3-carbohydrazide (PubChem CID 134034978) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-methyl-N'-(1-pyrimidin-2-ylpiperidine-3-carbonyl)indole-3-carbohydrazide.
| Compound Name | 1-methyl-N'-(1-pyrimidin-2-ylpiperidine-3-carbonyl)indole-3-carbohydrazide |
|---|---|
| PubChem CID | 134034978 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-methyl-N'-(1-pyrimidin-2-ylpiperidine-3-carbonyl)indole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)C2CCCN(c3ncccn3)C2)c2ccccc21 |
| InChI | InChI=1S/C20H22N6O2/c1-25-13-16(15-7-2-3-8-17(15)25)19(28)24-23-18(27)14-6-4-11-26(12-14)20-21-9-5-10-22-20/h2-3,5,7-10,13-14H,4,6,11-12H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | STQGTBBAUNNMNL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|