C22H24N4O4S — CID 17476809
1-methyl-N'-[1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]indole-3-carbohydrazide (PubChem CID 17476809) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 1-methyl-N'-[1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]indole-3-carbohydrazide.
| Compound Name | 1-methyl-N'-[1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 17476809 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1-methyl-N'-[1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]indole-3-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)NNC(=O)c2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H24N4O4S/c1-15-9-11-16(12-10-15)31(29,30)26-13-5-8-20(26)22(28)24-23-21(27)18-14-25(2)19-7-4-3-6-17(18)19/h3-4,6-7,9-12,14,20H,5,8,13H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | BEMOAGQAPHDJNL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|