C25H23BrN2O4S — CID 16924886
N-(2-benzoyl-4-bromophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 16924886) has the molecular formula C25H23BrN2O4S and a molecular weight of 527.44 g/mol. Its IUPAC name is N-(2-benzoyl-4-bromophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-benzoyl-4-bromophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16924886 |
| Molecular Formula | C25H23BrN2O4S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | N-(2-benzoyl-4-bromophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2ccc(Br)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23BrN2O4S/c1-17-9-12-20(13-10-17)33(31,32)28-15-5-8-23(28)25(30)27-22-14-11-19(26)16-21(22)24(29)18-6-3-2-4-7-18/h2-4,6-7,9-14,16,23H,5,8,15H2,1H3,(H,27,30) |
| InChIKey | OCQATSBNDCZFSU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |