C23H25N5O5S — CID 27564604
3-methyl-N'-[(2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carbonyl]-4-oxophthalazine-1-carbohydrazide (PubChem CID 27564604) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is 3-methyl-N'-[(2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carbonyl]-4-oxophthalazine-1-carbohydrazide.
| Compound Name | 3-methyl-N'-[(2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carbonyl]-4-oxophthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27564604 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-methyl-N'-[(2R)-1-(4-methylphenyl)sulfonylpiperidine-2-carbonyl]-4-oxophthalazine-1-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2C(=O)NNC(=O)c2nn(C)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H25N5O5S/c1-15-10-12-16(13-11-15)34(32,33)28-14-6-5-9-19(28)21(29)24-25-22(30)20-17-7-3-4-8-18(17)23(31)27(2)26-20/h3-4,7-8,10-13,19H,5-6,9,14H2,1-2H3,(H,24,29)(H,25,30)/t19-/m1/s1 |
| InChIKey | NNIVDEMFKSHFRB-LJQANCHMSA-N |
| XLogP | 1.25 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|