C22H31N5O5S — CID 55526615
4-oxo-3-pentyl-N'-(1-propylsulfonylpyrrolidine-2-carbonyl)phthalazine-1-carbohydrazide (PubChem CID 55526615) has the molecular formula C22H31N5O5S and a molecular weight of 477.59 g/mol. Its IUPAC name is 4-oxo-3-pentyl-N'-(1-propylsulfonylpyrrolidine-2-carbonyl)phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-3-pentyl-N'-(1-propylsulfonylpyrrolidine-2-carbonyl)phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 55526615 |
| Molecular Formula | C22H31N5O5S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-oxo-3-pentyl-N'-(1-propylsulfonylpyrrolidine-2-carbonyl)phthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)C2CCCN2S(=O)(=O)CCC)c2ccccc2c1=O |
| InChI | InChI=1S/C22H31N5O5S/c1-3-5-8-13-26-22(30)17-11-7-6-10-16(17)19(25-26)21(29)24-23-20(28)18-12-9-14-27(18)33(31,32)15-4-2/h6-7,10-11,18H,3-5,8-9,12-15H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | FXKRAMAQYHFWLX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|