C24H27N5O5S — CID 27679050
N-cyclopropyl-3-[[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 27679050) has the molecular formula C24H27N5O5S and a molecular weight of 497.58 g/mol. Its IUPAC name is N-cyclopropyl-3-[[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-3-[[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27679050 |
| Molecular Formula | C24H27N5O5S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-cyclopropyl-3-[[(4-oxo-3-pentylphthalazine-1-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)c2cccc(S(=O)(=O)NC3CC3)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H27N5O5S/c1-2-3-6-14-29-24(32)20-11-5-4-10-19(20)21(27-29)23(31)26-25-22(30)16-8-7-9-18(15-16)35(33,34)28-17-12-13-17/h4-5,7-11,15,17,28H,2-3,6,12-14H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | MXQMKPHVAYBQME-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|