C26H29N5O4 — CID 32755900
4-oxo-N'-[4-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]-3-pentylphthalazine-1-carbohydrazide (PubChem CID 32755900) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-oxo-N'-[4-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-N'-[4-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 32755900 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 4-oxo-N'-[4-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)c2ccc(CN3CCCC3=O)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C26H29N5O4/c1-2-3-6-16-31-26(35)21-9-5-4-8-20(21)23(29-31)25(34)28-27-24(33)19-13-11-18(12-14-19)17-30-15-7-10-22(30)32/h4-5,8-9,11-14H,2-3,6-7,10,15-17H2,1H3,(H,27,33)(H,28,34) |
| InChIKey | VQBUBTRDUMVCJP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|