C25H26N6O4 — CID 24540574
4-oxo-N'-(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-3-pentylphthalazine-1-carbohydrazide (PubChem CID 24540574) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is 4-oxo-N'-(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-3-pentylphthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-N'-(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-3-pentylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 24540574 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-oxo-N'-(6-oxo-1-phenyl-4,5-dihydropyridazine-3-carbonyl)-3-pentylphthalazine-1-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)C2=NN(c3ccccc3)C(=O)CC2)c2ccccc2c1=O |
| InChI | InChI=1S/C25H26N6O4/c1-2-3-9-16-30-25(35)19-13-8-7-12-18(19)22(29-30)24(34)27-26-23(33)20-14-15-21(32)31(28-20)17-10-5-4-6-11-17/h4-8,10-13H,2-3,9,14-16H2,1H3,(H,26,33)(H,27,34) |
| InChIKey | BVKRXMLLCDPYMH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|